C17H13NO3S — CID 6043558
(2E)-2-[(3-methylphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylic acid (PubChem CID 6043558) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2E)-2-[(3-methylphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylic acid.
| Compound Name | (2E)-2-[(3-methylphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 6043558 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2E)-2-[(3-methylphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylic acid |
| SMILES | Cc1cccc(/C=C2/Sc3ccc(C(=O)O)cc3NC2=O)c1 |
| InChI | InChI=1S/C17H13NO3S/c1-10-3-2-4-11(7-10)8-15-16(19)18-13-9-12(17(20)21)5-6-14(13)22-15/h2-9H,1H3,(H,18,19)(H,20,21)/b15-8+ |
| InChIKey | HHYPTMJGXFQDCH-OVCLIPMQSA-N |
| XLogP | 3.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|