C18H15NO4S — CID 6242783
methyl (2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 6242783) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is methyl (2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | methyl (2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 6242783 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | methyl (2E)-2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1cccc(OC)c1)S2 |
| InChI | InChI=1S/C18H15NO4S/c1-22-13-5-3-4-11(8-13)9-16-17(20)19-14-10-12(18(21)23-2)6-7-15(14)24-16/h3-10H,1-2H3,(H,19,20)/b16-9+ |
| InChIKey | VKRVGWKEKVAWQX-CXUHLZMHSA-N |
| XLogP | 3.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|