C27H36N3O3S+ — CID 5086994
2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]amino]ethyl-bis(2-methylpropyl)azanium (PubChem CID 5086994) has the molecular formula C27H36N3O3S+ and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]amino]ethyl-bis(2-methylpropyl)azanium.
| Compound Name | 2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]amino]ethyl-bis(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 5086994 |
| Molecular Formula | C27H36N3O3S+ |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-[[2-[(3-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]amino]ethyl-bis(2-methylpropyl)azanium |
| SMILES | COc1cccc(C=C2Sc3ccc(C(=O)NCC[NH+](CC(C)C)CC(C)C)cc3NC2=O)c1 |
| InChI | InChI=1S/C27H35N3O3S/c1-18(2)16-30(17-19(3)4)12-11-28-26(31)21-9-10-24-23(15-21)29-27(32)25(34-24)14-20-7-6-8-22(13-20)33-5/h6-10,13-15,18-19H,11-12,16-17H2,1-5H3,(H,28,31)(H,29,32)/p+1 |
| InChIKey | JVFXJKWDECTSQY-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|