C15H10ClNOS — CID 2302262
(2E)-2-[(4-chlorophenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 2302262) has the molecular formula C15H10ClNOS and a molecular weight of 287.77 g/mol. Its IUPAC name is (2E)-2-[(4-chlorophenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[(4-chlorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 2302262 |
| Molecular Formula | C15H10ClNOS |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (2E)-2-[(4-chlorophenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClNOS/c16-11-7-5-10(6-8-11)9-14-15(18)17-12-3-1-2-4-13(12)19-14/h1-9H,(H,17,18)/b14-9+ |
| InChIKey | RSOFQMQXFIUPRQ-NTEUORMPSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|