C22H16ClNO2S — CID 126101980
(2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126101980) has the molecular formula C22H16ClNO2S and a molecular weight of 393.90 g/mol. Its IUPAC name is (2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126101980 |
| Molecular Formula | C22H16ClNO2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (2Z)-2-[[3-[(4-chlorophenyl)methoxy]phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1cccc(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H16ClNO2S/c23-17-10-8-15(9-11-17)14-26-18-5-3-4-16(12-18)13-21-22(25)24-19-6-1-2-7-20(19)27-21/h1-13H,14H2,(H,24,25)/b21-13- |
| InChIKey | IMPWEFMDWCRRJH-BKUYFWCQSA-N |
| XLogP | 6.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|