C23H16BrNO4S — CID 126109738
4-[[2-bromo-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 126109738) has the molecular formula C23H16BrNO4S and a molecular weight of 482.36 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126109738 |
| Molecular Formula | C23H16BrNO4S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 4-[[2-bromo-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1ccc(OCc2ccc(C(=O)O)cc2)c(Br)c1 |
| InChI | InChI=1S/C23H16BrNO4S/c24-17-11-15(12-21-22(26)25-18-3-1-2-4-20(18)30-21)7-10-19(17)29-13-14-5-8-16(9-6-14)23(27)28/h1-12H,13H2,(H,25,26)(H,27,28)/b21-12- |
| InChIKey | BHKTWYYNBCPHJR-MTJSOVHGSA-N |
| XLogP | 5.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|