C23H16BrFN2O2S — CID 135642512
(5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135642512) has the molecular formula C23H16BrFN2O2S and a molecular weight of 483.36 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135642512 |
| Molecular Formula | C23H16BrFN2O2S |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | (5E)-5-[(3-bromo-4-phenylmethoxyphenyl)methylidene]-2-(4-fluorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(F)cc2)S/C1=C/c1ccc(OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C23H16BrFN2O2S/c24-19-12-16(6-11-20(19)29-14-15-4-2-1-3-5-15)13-21-22(28)27-23(30-21)26-18-9-7-17(25)8-10-18/h1-13H,14H2,(H,26,27,28)/b21-13+ |
| InChIKey | CFWXMFWMICFBQN-FYJGNVAPSA-N |
| XLogP | 6.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|