C19H17BrN2O2S — CID 137074846
(5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 137074846) has the molecular formula C19H17BrN2O2S and a molecular weight of 417.33 g/mol. Its IUPAC name is (5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137074846 |
| Molecular Formula | C19H17BrN2O2S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | (5Z)-5-[(3-bromo-4-propoxyphenyl)methylidene]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CCCOc1ccc(/C=C2\S/C(=N/c3ccccc3)NC2=O)cc1Br |
| InChI | InChI=1S/C19H17BrN2O2S/c1-2-10-24-16-9-8-13(11-15(16)20)12-17-18(23)22-19(25-17)21-14-6-4-3-5-7-14/h3-9,11-12H,2,10H2,1H3,(H,21,22,23)/b17-12- |
| InChIKey | RYBUGBSQLQUZHZ-ATVHPVEESA-N |
| XLogP | 5.13 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|