C26H20BrIN2O4S — CID 137021147
4-[[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid (PubChem CID 137021147) has the molecular formula C26H20BrIN2O4S and a molecular weight of 663.33 g/mol. Its IUPAC name is 4-[[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 137021147 |
| Molecular Formula | C26H20BrIN2O4S |
| Molecular Weight | 663.33 g/mol |
| Exact Mass | 661.94 |
| IUPAC Name | 4-[[4-[(Z)-[2-(4-bromo-3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-iodophenoxy]methyl]benzoic acid |
| SMILES | Cc1cc(/N=C2\NC(=O)/C(=C/c3ccc(OCc4ccc(C(=O)O)cc4)c(I)c3)S2)cc(C)c1Br |
| InChI | InChI=1S/C26H20BrIN2O4S/c1-14-9-19(10-15(2)23(14)27)29-26-30-24(31)22(35-26)12-17-5-8-21(20(28)11-17)34-13-16-3-6-18(7-4-16)25(32)33/h3-12H,13H2,1-2H3,(H,32,33)(H,29,30,31)/b22-12- |
| InChIKey | GNDTYASLTBEILM-UUYOSTAYSA-N |
| XLogP | 6.84 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.33 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|