C26H21BrN2O5S — CID 137044081
4-[[4-[(E)-[2-(4-bromo-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 137044081) has the molecular formula C26H21BrN2O5S and a molecular weight of 553.43 g/mol. Its IUPAC name is 4-[[4-[(E)-[2-(4-bromo-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[2-(4-bromo-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 137044081 |
| Molecular Formula | C26H21BrN2O5S |
| Molecular Weight | 553.43 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 4-[[4-[(E)-[2-(4-bromo-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc(Br)cc3C)NC2=O)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H21BrN2O5S/c1-15-11-19(27)8-9-20(15)28-26-29-24(30)23(35-26)13-17-5-10-21(22(12-17)33-2)34-14-16-3-6-18(7-4-16)25(31)32/h3-13H,14H2,1-2H3,(H,31,32)(H,28,29,30)/b23-13+ |
| InChIKey | PCLGMFJADGNDFF-YDZHTSKRSA-N |
| XLogP | 5.93 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|