C14H11NOS — CID 90983657
2-(cyclopenta-1,4-dien-1-ylmethylidene)-4H-1,4-benzothiazin-3-one (PubChem CID 90983657) has the molecular formula C14H11NOS and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-(cyclopenta-1,4-dien-1-ylmethylidene)-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-(cyclopenta-1,4-dien-1-ylmethylidene)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 90983657 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-(cyclopenta-1,4-dien-1-ylmethylidene)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1=CC1=CCC=C1 |
| InChI | InChI=1S/C14H11NOS/c16-14-13(9-10-5-1-2-6-10)17-12-8-4-3-7-11(12)15-14/h1,3-9H,2H2,(H,15,16) |
| InChIKey | ZLQYQNPVTOSWKV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|