C11H11NO2S — CID 20678291
(2E)-2-(ethoxymethylidene)-4H-1,4-benzothiazin-3-one (PubChem CID 20678291) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is (2E)-2-(ethoxymethylidene)-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-(ethoxymethylidene)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 20678291 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2E)-2-(ethoxymethylidene)-4H-1,4-benzothiazin-3-one |
| SMILES | CCO/C=C1/Sc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO2S/c1-2-14-7-10-11(13)12-8-5-3-4-6-9(8)15-10/h3-7H,2H2,1H3,(H,12,13)/b10-7+ |
| InChIKey | OAPLWHJMMXODKS-JXMROGBWSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|