C16H10F3NOS — CID 5476828
(2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 5476828) has the molecular formula C16H10F3NOS and a molecular weight of 321.32 g/mol. Its IUPAC name is (2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 5476828 |
| Molecular Formula | C16H10F3NOS |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | (2Z)-2-[[3-(trifluoromethyl)phenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F3NOS/c17-16(18,19)11-5-3-4-10(8-11)9-14-15(21)20-12-6-1-2-7-13(12)22-14/h1-9H,(H,20,21)/b14-9- |
| InChIKey | CPGYZWDTGDRKHK-ZROIWOOFSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|