C17H17F3N2OS — CID 135490221
(5Z)-2-cyclohexylimino-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135490221) has the molecular formula C17H17F3N2OS and a molecular weight of 354.40 g/mol. Its IUPAC name is (5Z)-2-cyclohexylimino-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-cyclohexylimino-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135490221 |
| Molecular Formula | C17H17F3N2OS |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (5Z)-2-cyclohexylimino-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)S/C1=C\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2OS/c18-17(19,20)12-6-4-5-11(9-12)10-14-15(23)22-16(24-14)21-13-7-2-1-3-8-13/h4-6,9-10,13H,1-3,7-8H2,(H,21,22,23)/b14-10- |
| InChIKey | BWGPYGKWCDIQKF-UVTDQMKNSA-N |
| XLogP | 4.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|