C15H13BrN2O2S — CID 126113213
(2Z)-2-[[4-bromo-5-(dimethylamino)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126113213) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is (2Z)-2-[[4-bromo-5-(dimethylamino)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[4-bromo-5-(dimethylamino)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126113213 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | (2Z)-2-[[4-bromo-5-(dimethylamino)furan-2-yl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | CN(C)c1oc(/C=C2\Sc3ccccc3NC2=O)cc1Br |
| InChI | InChI=1S/C15H13BrN2O2S/c1-18(2)15-10(16)7-9(20-15)8-13-14(19)17-11-5-3-4-6-12(11)21-13/h3-8H,1-2H3,(H,17,19)/b13-8- |
| InChIKey | PUHFVNDUBSMDEO-JYRVWZFOSA-N |
| XLogP | 4.19 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|