C13H7Br2NO2S — CID 126109071
(2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126109071) has the molecular formula C13H7Br2NO2S and a molecular weight of 401.08 g/mol. Its IUPAC name is (2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126109071 |
| Molecular Formula | C13H7Br2NO2S |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | (2Z)-2-[(4,5-dibromofuran-2-yl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C13H7Br2NO2S/c14-8-5-7(18-12(8)15)6-11-13(17)16-9-3-1-2-4-10(9)19-11/h1-6H,(H,16,17)/b11-6- |
| InChIKey | TWJJHMBEQNBJNX-WDZFZDKYSA-N |
| XLogP | 4.89 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|