C17H14N2O2S — CID 7996424
N-[4-[(E)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl]acetamide (PubChem CID 7996424) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[4-[(E)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 7996424 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[4-[(E)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2/Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C17H14N2O2S/c1-11(20)18-13-8-6-12(7-9-13)10-16-17(21)19-14-4-2-3-5-15(14)22-16/h2-10H,1H3,(H,18,20)(H,19,21)/b16-10+ |
| InChIKey | VXNGGTFVIFHTHB-MHWRWJLKSA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|