C15H18N2O2S — CID 92756576
(2E)-N-[(2S)-3-methylbutan-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-ylidene)acetamide (PubChem CID 92756576) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (2E)-N-[(2S)-3-methylbutan-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-ylidene)acetamide.
| Compound Name | (2E)-N-[(2S)-3-methylbutan-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-ylidene)acetamide |
|---|---|
| PubChem CID | 92756576 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (2E)-N-[(2S)-3-methylbutan-2-yl]-2-(3-oxo-4H-1,4-benzothiazin-2-ylidene)acetamide |
| SMILES | CC(C)[C@H](C)NC(=O)/C=C1/Sc2ccccc2NC1=O |
| InChI | InChI=1S/C15H18N2O2S/c1-9(2)10(3)16-14(18)8-13-15(19)17-11-6-4-5-7-12(11)20-13/h4-10H,1-3H3,(H,16,18)(H,17,19)/b13-8+/t10-/m0/s1 |
| InChIKey | WBIJEFISRYYJAQ-XNFYSYIQSA-N |
| XLogP | 2.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|