C16H19ClN2O2S — CID 71959312
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-ylidene)-N-(3,3-dimethylbutan-2-yl)acetamide (PubChem CID 71959312) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-ylidene)-N-(3,3-dimethylbutan-2-yl)acetamide.
| Compound Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-ylidene)-N-(3,3-dimethylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 71959312 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-ylidene)-N-(3,3-dimethylbutan-2-yl)acetamide |
| SMILES | CC(NC(=O)C=C1Sc2ccc(Cl)cc2NC1=O)C(C)(C)C |
| InChI | InChI=1S/C16H19ClN2O2S/c1-9(16(2,3)4)18-14(20)8-13-15(21)19-11-7-10(17)5-6-12(11)22-13/h5-9H,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | DPQMBFJVYSRBGX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|