C14H13ClN2O2S2 — CID 46087509
(2E)-6-chloro-2-(2-oxo-2-thiomorpholin-4-ylethylidene)-4H-1,4-benzothiazin-3-one (PubChem CID 46087509) has the molecular formula C14H13ClN2O2S2 and a molecular weight of 340.86 g/mol. Its IUPAC name is (2E)-6-chloro-2-(2-oxo-2-thiomorpholin-4-ylethylidene)-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-6-chloro-2-(2-oxo-2-thiomorpholin-4-ylethylidene)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46087509 |
| Molecular Formula | C14H13ClN2O2S2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | (2E)-6-chloro-2-(2-oxo-2-thiomorpholin-4-ylethylidene)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2cc(Cl)ccc2S/C1=C/C(=O)N1CCSCC1 |
| InChI | InChI=1S/C14H13ClN2O2S2/c15-9-1-2-11-10(7-9)16-14(19)12(21-11)8-13(18)17-3-5-20-6-4-17/h1-2,7-8H,3-6H2,(H,16,19)/b12-8+ |
| InChIKey | DLOQFNDEQVRDCF-XYOKQWHBSA-N |
| XLogP | 2.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|