C16H15Cl2N3O2S — CID 135443319
(5Z)-2-(2,6-dichlorophenyl)imino-5-(2-oxo-2-piperidin-1-ylethylidene)-1,3-thiazolidin-4-one (PubChem CID 135443319) has the molecular formula C16H15Cl2N3O2S and a molecular weight of 384.29 g/mol. Its IUPAC name is (5Z)-2-(2,6-dichlorophenyl)imino-5-(2-oxo-2-piperidin-1-ylethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,6-dichlorophenyl)imino-5-(2-oxo-2-piperidin-1-ylethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135443319 |
| Molecular Formula | C16H15Cl2N3O2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (5Z)-2-(2,6-dichlorophenyl)imino-5-(2-oxo-2-piperidin-1-ylethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)S/C1=C\C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H15Cl2N3O2S/c17-10-5-4-6-11(18)14(10)19-16-20-15(23)12(24-16)9-13(22)21-7-2-1-3-8-21/h4-6,9H,1-3,7-8H2,(H,19,20,23)/b12-9- |
| InChIKey | ZJAFQEPKACAPLY-XFXZXTDPSA-N |
| XLogP | 3.74 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|