C22H23Cl2N3O3S — CID 142246617
(2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-methylacetamide;(1E,3Z,5Z)-1-ethoxycycloocta-1,3,5-triene (PubChem CID 142246617) has the molecular formula C22H23Cl2N3O3S and a molecular weight of 480.42 g/mol. Its IUPAC name is (2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-methylacetamide;(1E,3Z,5Z)-1-ethoxycycloocta-1,3,5-triene.
| Compound Name | (2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-methylacetamide;(1E,3Z,5Z)-1-ethoxycycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 142246617 |
| Molecular Formula | C22H23Cl2N3O3S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | (2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-methylacetamide;(1E,3Z,5Z)-1-ethoxycycloocta-1,3,5-triene |
| SMILES | CCO/C1=C/C=C\C=C/CC1.CNC(=O)/C=C1\S/C(=N\c2c(Cl)cccc2Cl)NC1=O |
| InChI | InChI=1S/C12H9Cl2N3O2S.C10H14O/c1-15-9(18)5-8-11(19)17-12(20-8)16-10-6(13)3-2-4-7(10)14;1-2-11-10-8-6-4-3-5-7-9-10/h2-5H,1H3,(H,15,18)(H,16,17,19);3-6,8H,2,7,9H2,1H3/b8-5-;5-3-,6-4-,10-8+ |
| InChIKey | RXGMNBBXCMJZLB-PRFIVHKPSA-N |
| XLogP | 5.29 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|