C19H11Cl2N3OS — CID 135524022
(5Z)-2-(2,6-dichlorophenyl)imino-5-(isoquinolin-3-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 135524022) has the molecular formula C19H11Cl2N3OS and a molecular weight of 400.29 g/mol. Its IUPAC name is (5Z)-2-(2,6-dichlorophenyl)imino-5-(isoquinolin-3-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2,6-dichlorophenyl)imino-5-(isoquinolin-3-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135524022 |
| Molecular Formula | C19H11Cl2N3OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | (5Z)-2-(2,6-dichlorophenyl)imino-5-(isoquinolin-3-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)S/C1=C\c1cc2ccccc2cn1 |
| InChI | InChI=1S/C19H11Cl2N3OS/c20-14-6-3-7-15(21)17(14)23-19-24-18(25)16(26-19)9-13-8-11-4-1-2-5-12(11)10-22-13/h1-10H,(H,23,24,25)/b16-9- |
| InChIKey | FBEVTRXOEDMLKF-SXGWCWSVSA-N |
| XLogP | 5.43 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|