C20H11Cl2N3O3S — CID 136623567
6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylic acid (PubChem CID 136623567) has the molecular formula C20H11Cl2N3O3S and a molecular weight of 444.30 g/mol. Its IUPAC name is 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylic acid.
| Compound Name | 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 136623567 |
| Molecular Formula | C20H11Cl2N3O3S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylic acid |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)SC1=Cc1ccc2ncc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C20H11Cl2N3O3S/c21-13-2-1-3-14(22)17(13)24-20-25-18(26)16(29-20)7-10-4-5-15-11(6-10)8-12(9-23-15)19(27)28/h1-9H,(H,27,28)(H,24,25,26) |
| InChIKey | BDLLIZIJOLEVNG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|