C19H10Cl3N3OS — CID 136655560
5-[(8-chloroquinolin-6-yl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136655560) has the molecular formula C19H10Cl3N3OS and a molecular weight of 434.74 g/mol. Its IUPAC name is 5-[(8-chloroquinolin-6-yl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(8-chloroquinolin-6-yl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136655560 |
| Molecular Formula | C19H10Cl3N3OS |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 5-[(8-chloroquinolin-6-yl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)SC1=Cc1cc(Cl)c2ncccc2c1 |
| InChI | InChI=1S/C19H10Cl3N3OS/c20-12-4-1-5-13(21)17(12)24-19-25-18(26)15(27-19)9-10-7-11-3-2-6-23-16(11)14(22)8-10/h1-9H,(H,24,25,26) |
| InChIKey | XWYMSZUVAXZQHA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|