C16H11Cl2N3O2S — CID 136600364
5-[(4-amino-3-hydroxyphenyl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136600364) has the molecular formula C16H11Cl2N3O2S and a molecular weight of 380.26 g/mol. Its IUPAC name is 5-[(4-amino-3-hydroxyphenyl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(4-amino-3-hydroxyphenyl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136600364 |
| Molecular Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 5-[(4-amino-3-hydroxyphenyl)methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Nc1ccc(C=C2S/C(=N\c3c(Cl)cccc3Cl)NC2=O)cc1O |
| InChI | InChI=1S/C16H11Cl2N3O2S/c17-9-2-1-3-10(18)14(9)20-16-21-15(23)13(24-16)7-8-4-5-11(19)12(22)6-8/h1-7,22H,19H2,(H,20,21,23) |
| InChIKey | NLEVTECCNXVIJX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|