C22H15Cl2N3O3S — CID 136509892
ethyl 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate (PubChem CID 136509892) has the molecular formula C22H15Cl2N3O3S and a molecular weight of 472.35 g/mol. Its IUPAC name is ethyl 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate.
| Compound Name | ethyl 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 136509892 |
| Molecular Formula | C22H15Cl2N3O3S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | ethyl 6-[[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C=C3S/C(=N\c4c(Cl)cccc4Cl)NC3=O)cc2c1 |
| InChI | InChI=1S/C22H15Cl2N3O3S/c1-2-30-21(29)14-10-13-8-12(6-7-17(13)25-11-14)9-18-20(28)27-22(31-18)26-19-15(23)4-3-5-16(19)24/h3-11H,2H2,1H3,(H,26,27,28) |
| InChIKey | RTQJDZGFVMEYTH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|