C21H16Cl2N4OS — CID 136500404
5-[[3-(cyclopropylmethyl)benzimidazol-5-yl]methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136500404) has the molecular formula C21H16Cl2N4OS and a molecular weight of 443.36 g/mol. Its IUPAC name is 5-[[3-(cyclopropylmethyl)benzimidazol-5-yl]methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-(cyclopropylmethyl)benzimidazol-5-yl]methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136500404 |
| Molecular Formula | C21H16Cl2N4OS |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 5-[[3-(cyclopropylmethyl)benzimidazol-5-yl]methylidene]-2-(2,6-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2c(Cl)cccc2Cl)SC1=Cc1ccc2ncn(CC3CC3)c2c1 |
| InChI | InChI=1S/C21H16Cl2N4OS/c22-14-2-1-3-15(23)19(14)25-21-26-20(28)18(29-21)9-13-6-7-16-17(8-13)27(11-24-16)10-12-4-5-12/h1-3,6-9,11-12H,4-5,10H2,(H,25,26,28) |
| InChIKey | KCFNONMCQCAKJS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|