C24H24ClN5O2S — CID 135490073
(5E)-2-(2-chlorophenyl)imino-5-[[3-(3-morpholin-4-ylpropyl)benzimidazol-5-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135490073) has the molecular formula C24H24ClN5O2S and a molecular weight of 482.01 g/mol. Its IUPAC name is (5E)-2-(2-chlorophenyl)imino-5-[[3-(3-morpholin-4-ylpropyl)benzimidazol-5-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-chlorophenyl)imino-5-[[3-(3-morpholin-4-ylpropyl)benzimidazol-5-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135490073 |
| Molecular Formula | C24H24ClN5O2S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (5E)-2-(2-chlorophenyl)imino-5-[[3-(3-morpholin-4-ylpropyl)benzimidazol-5-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccc2Cl)S/C1=C/c1ccc2ncn(CCCN3CCOCC3)c2c1 |
| InChI | InChI=1S/C24H24ClN5O2S/c25-18-4-1-2-5-19(18)27-24-28-23(31)22(33-24)15-17-6-7-20-21(14-17)30(16-26-20)9-3-8-29-10-12-32-13-11-29/h1-2,4-7,14-16H,3,8-13H2,(H,27,28,31)/b22-15+ |
| InChIKey | FGFIZJWHDNEVJQ-PXLXIMEGSA-N |
| XLogP | 4.30 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|