C20H19ClN6OS — CID 135512565
(5E)-2-(2-chlorophenyl)imino-5-[[3-[2-(dimethylamino)ethyl]benzotriazol-5-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 135512565) has the molecular formula C20H19ClN6OS and a molecular weight of 426.93 g/mol. Its IUPAC name is (5E)-2-(2-chlorophenyl)imino-5-[[3-[2-(dimethylamino)ethyl]benzotriazol-5-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2-chlorophenyl)imino-5-[[3-[2-(dimethylamino)ethyl]benzotriazol-5-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135512565 |
| Molecular Formula | C20H19ClN6OS |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (5E)-2-(2-chlorophenyl)imino-5-[[3-[2-(dimethylamino)ethyl]benzotriazol-5-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CN(C)CCn1nnc2ccc(/C=C3/S/C(=N\c4ccccc4Cl)NC3=O)cc21 |
| InChI | InChI=1S/C20H19ClN6OS/c1-26(2)9-10-27-17-11-13(7-8-16(17)24-25-27)12-18-19(28)23-20(29-18)22-15-6-4-3-5-14(15)21/h3-8,11-12H,9-10H2,1-2H3,(H,22,23,28)/b18-12+ |
| InChIKey | MKGJOGWSUPAXRQ-LDADJPATSA-N |
| XLogP | 3.54 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|