C22H21ClN4OS — CID 135437817
(5E)-5-[(2-tert-butyl-3-methylbenzimidazol-5-yl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135437817) has the molecular formula C22H21ClN4OS and a molecular weight of 424.96 g/mol. Its IUPAC name is (5E)-5-[(2-tert-butyl-3-methylbenzimidazol-5-yl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2-tert-butyl-3-methylbenzimidazol-5-yl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135437817 |
| Molecular Formula | C22H21ClN4OS |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (5E)-5-[(2-tert-butyl-3-methylbenzimidazol-5-yl)methylidene]-2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cn1c(C(C)(C)C)nc2ccc(/C=C3/S/C(=N\c4ccccc4Cl)NC3=O)cc21 |
| InChI | InChI=1S/C22H21ClN4OS/c1-22(2,3)20-24-16-10-9-13(11-17(16)27(20)4)12-18-19(28)26-21(29-18)25-15-8-6-5-7-14(15)23/h5-12H,1-4H3,(H,25,26,28)/b18-12+ |
| InChIKey | FTMLFOWTNQYDRM-LDADJPATSA-N |
| XLogP | 5.42 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|