C15H15Cl2N3O4S — CID 135457050
(2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-(2,2-dimethoxyethyl)acetamide (PubChem CID 135457050) has the molecular formula C15H15Cl2N3O4S and a molecular weight of 404.28 g/mol. Its IUPAC name is (2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-(2,2-dimethoxyethyl)acetamide.
| Compound Name | (2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-(2,2-dimethoxyethyl)acetamide |
|---|---|
| PubChem CID | 135457050 |
| Molecular Formula | C15H15Cl2N3O4S |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | (2Z)-2-[2-(2,6-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]-N-(2,2-dimethoxyethyl)acetamide |
| SMILES | COC(CNC(=O)/C=C1\S/C(=N\c2c(Cl)cccc2Cl)NC1=O)OC |
| InChI | InChI=1S/C15H15Cl2N3O4S/c1-23-12(24-2)7-18-11(21)6-10-14(22)20-15(25-10)19-13-8(16)4-3-5-9(13)17/h3-6,12H,7H2,1-2H3,(H,18,21)(H,19,20,22)/b10-6- |
| InChIKey | RYDPBGLNOQSTQW-POHAHGRESA-N |
| XLogP | 2.46 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|