C19H12ClF3N2O3S — CID 135844591
methyl 4-[(Z)-[2-[2-chloro-5-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 135844591) has the molecular formula C19H12ClF3N2O3S and a molecular weight of 440.83 g/mol. Its IUPAC name is methyl 4-[(Z)-[2-[2-chloro-5-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[2-[2-chloro-5-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 135844591 |
| Molecular Formula | C19H12ClF3N2O3S |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | methyl 4-[(Z)-[2-[2-chloro-5-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\S/C(=N/c3cc(C(F)(F)F)ccc3Cl)NC2=O)cc1 |
| InChI | InChI=1S/C19H12ClF3N2O3S/c1-28-17(27)11-4-2-10(3-5-11)8-15-16(26)25-18(29-15)24-14-9-12(19(21,22)23)6-7-13(14)20/h2-9H,1H3,(H,24,25,26)/b15-8- |
| InChIKey | SKCBIECXDBQYSA-NVNXTCNLSA-N |
| XLogP | 5.04 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|