C19H14ClF3N2O3S — CID 135486803
2-[2-chloro-5-(trifluoromethyl)phenyl]imino-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135486803) has the molecular formula C19H14ClF3N2O3S and a molecular weight of 442.85 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]imino-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]imino-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135486803 |
| Molecular Formula | C19H14ClF3N2O3S |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]imino-5-[(3,4-dimethoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2S/C(=N\c3cc(C(F)(F)F)ccc3Cl)NC2=O)cc1OC |
| InChI | InChI=1S/C19H14ClF3N2O3S/c1-27-14-6-3-10(7-15(14)28-2)8-16-17(26)25-18(29-16)24-13-9-11(19(21,22)23)4-5-12(13)20/h3-9H,1-2H3,(H,24,25,26) |
| InChIKey | DOCQOKGYZRZLQS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|