C17H18Cl2N4O2S — CID 136649356
2-(2,6-dichlorophenyl)imino-5-[2-(4-ethylpiperazin-1-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one (PubChem CID 136649356) has the molecular formula C17H18Cl2N4O2S and a molecular weight of 413.33 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)imino-5-[2-(4-ethylpiperazin-1-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,6-dichlorophenyl)imino-5-[2-(4-ethylpiperazin-1-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136649356 |
| Molecular Formula | C17H18Cl2N4O2S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-(2,6-dichlorophenyl)imino-5-[2-(4-ethylpiperazin-1-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1CCN(C(=O)C=C2S/C(=N\c3c(Cl)cccc3Cl)NC2=O)CC1 |
| InChI | InChI=1S/C17H18Cl2N4O2S/c1-2-22-6-8-23(9-7-22)14(24)10-13-16(25)21-17(26-13)20-15-11(18)4-3-5-12(15)19/h3-5,10H,2,6-9H2,1H3,(H,20,21,25) |
| InChIKey | KSQGMCZSCVFVCV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|