C17H12Cl2N2O2S — CID 135834310
(5Z)-5-[(2,6-dichlorophenyl)methylidene]-2-(2-hydroxy-5-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135834310) has the molecular formula C17H12Cl2N2O2S and a molecular weight of 379.27 g/mol. Its IUPAC name is (5Z)-5-[(2,6-dichlorophenyl)methylidene]-2-(2-hydroxy-5-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-2-(2-hydroxy-5-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135834310 |
| Molecular Formula | C17H12Cl2N2O2S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-2-(2-hydroxy-5-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(O)c(/N=C2\NC(=O)/C(=C/c3c(Cl)cccc3Cl)S2)c1 |
| InChI | InChI=1S/C17H12Cl2N2O2S/c1-9-5-6-14(22)13(7-9)20-17-21-16(23)15(24-17)8-10-11(18)3-2-4-12(10)19/h2-8,22H,1H3,(H,20,21,23)/b15-8- |
| InChIKey | UMLAKGAWJIFACU-NVNXTCNLSA-N |
| XLogP | 4.90 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|