C18H12Cl2N2O3S — CID 135634697
3-[[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid (PubChem CID 135634697) has the molecular formula C18H12Cl2N2O3S and a molecular weight of 407.28 g/mol. Its IUPAC name is 3-[[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 135634697 |
| Molecular Formula | C18H12Cl2N2O3S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 3-[[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1/N=C1\NC(=O)/C(=C/c2c(Cl)cccc2Cl)S1 |
| InChI | InChI=1S/C18H12Cl2N2O3S/c1-9-5-6-10(17(24)25)7-14(9)21-18-22-16(23)15(26-18)8-11-12(19)3-2-4-13(11)20/h2-8H,1H3,(H,24,25)(H,21,22,23)/b15-8- |
| InChIKey | HRBMGMNBPKGVND-NVNXTCNLSA-N |
| XLogP | 4.89 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|