C21H19ClN2O4S — CID 137064803
ethyl 2-[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 137064803) has the molecular formula C21H19ClN2O4S and a molecular weight of 430.91 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 137064803 |
| Molecular Formula | C21H19ClN2O4S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | ethyl 2-[4-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2\S/C(=N/c3cccc(Cl)c3C)NC2=O)cc1 |
| InChI | InChI=1S/C21H19ClN2O4S/c1-3-27-19(25)12-28-15-9-7-14(8-10-15)11-18-20(26)24-21(29-18)23-17-6-4-5-16(22)13(17)2/h4-11H,3,12H2,1-2H3,(H,23,24,26)/b18-11- |
| InChIKey | UJHXZBBJTYPNBP-WQRHYEAKSA-N |
| XLogP | 4.48 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|