C25H19ClN2O4S — CID 137077241
4-[[4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 137077241) has the molecular formula C25H19ClN2O4S and a molecular weight of 478.96 g/mol. Its IUPAC name is 4-[[4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 137077241 |
| Molecular Formula | C25H19ClN2O4S |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 4-[[4-[(E)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1c(Cl)cccc1/N=C1\NC(=O)/C(=C\c2ccc(OCc3ccc(C(=O)O)cc3)cc2)S1 |
| InChI | InChI=1S/C25H19ClN2O4S/c1-15-20(26)3-2-4-21(15)27-25-28-23(29)22(33-25)13-16-7-11-19(12-8-16)32-14-17-5-9-18(10-6-17)24(30)31/h2-13H,14H2,1H3,(H,30,31)(H,27,28,29)/b22-13+ |
| InChIKey | AOYKJVGUWMZQNS-LPYMAVHISA-N |
| XLogP | 5.82 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|