C22H20Cl2N2O5S — CID 135527530
ethyl 2-[4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate (PubChem CID 135527530) has the molecular formula C22H20Cl2N2O5S and a molecular weight of 495.38 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 135527530 |
| Molecular Formula | C22H20Cl2N2O5S |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | ethyl 2-[4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=C2S/C(=N\c3cccc(Cl)c3Cl)NC2=O)cc1OCC |
| InChI | InChI=1S/C22H20Cl2N2O5S/c1-3-29-17-10-13(8-9-16(17)31-12-19(27)30-4-2)11-18-21(28)26-22(32-18)25-15-7-5-6-14(23)20(15)24/h5-11H,3-4,12H2,1-2H3,(H,25,26,28) |
| InChIKey | GCQIZAXQMGZOHC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|