C20H15Cl3N2O5S — CID 137080070
methyl 2-[2-chloro-4-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 137080070) has the molecular formula C20H15Cl3N2O5S and a molecular weight of 501.78 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-4-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 137080070 |
| Molecular Formula | C20H15Cl3N2O5S |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 499.98 |
| IUPAC Name | methyl 2-[2-chloro-4-[(E)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(/C=C2/S/C(=N\c3cccc(Cl)c3Cl)NC2=O)cc1OC |
| InChI | InChI=1S/C20H15Cl3N2O5S/c1-28-14-7-10(6-12(22)18(14)30-9-16(26)29-2)8-15-19(27)25-20(31-15)24-13-5-3-4-11(21)17(13)23/h3-8H,9H2,1-2H3,(H,24,25,27)/b15-8+ |
| InChIKey | HWACRWLNTOTDOD-OVCLIPMQSA-N |
| XLogP | 5.10 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|