C20H15Cl2IN2O3S — CID 137044519
(5E)-2-(2,3-dichlorophenyl)imino-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137044519) has the molecular formula C20H15Cl2IN2O3S and a molecular weight of 561.23 g/mol. Its IUPAC name is (5E)-2-(2,3-dichlorophenyl)imino-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,3-dichlorophenyl)imino-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137044519 |
| Molecular Formula | C20H15Cl2IN2O3S |
| Molecular Weight | 561.23 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | (5E)-2-(2,3-dichlorophenyl)imino-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(I)cc(/C=C2/S/C(=N\c3cccc(Cl)c3Cl)NC2=O)cc1OC |
| InChI | InChI=1S/C20H15Cl2IN2O3S/c1-3-7-28-18-13(23)8-11(9-15(18)27-2)10-16-19(26)25-20(29-16)24-14-6-4-5-12(21)17(14)22/h3-6,8-10H,1,7H2,2H3,(H,24,25,26)/b16-10+ |
| InChIKey | VHSUNOOXTJUVDS-MHWRWJLKSA-N |
| XLogP | 6.06 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.23 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|