C18H19F3N2O2S — CID 46087504
(2E)-2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethylidene]-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 46087504) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is (2E)-2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethylidene]-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethylidene]-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46087504 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (2E)-2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethylidene]-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | CC1CC(C)CN(C(=O)/C=C2/Sc3ccc(C(F)(F)F)cc3NC2=O)C1 |
| InChI | InChI=1S/C18H19F3N2O2S/c1-10-5-11(2)9-23(8-10)16(24)7-15-17(25)22-13-6-12(18(19,20)21)3-4-14(13)26-15/h3-4,6-7,10-11H,5,8-9H2,1-2H3,(H,22,25)/b15-7+ |
| InChIKey | QJMSQIZVBOKBET-VIZOYTHASA-N |
| XLogP | 4.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|