C18H19F3N4O3S — CID 87386998
(5E)-5-[[2-[4-(3-aminopropanoyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87386998) has the molecular formula C18H19F3N4O3S and a molecular weight of 428.44 g/mol. Its IUPAC name is (5E)-5-[[2-[4-(3-aminopropanoyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-(3-aminopropanoyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87386998 |
| Molecular Formula | C18H19F3N4O3S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (5E)-5-[[2-[4-(3-aminopropanoyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | NCCC(=O)N1CCN(c2ccc(C(F)(F)F)cc2/C=C2/SC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C18H19F3N4O3S/c19-18(20,21)12-1-2-13(11(9-12)10-14-16(27)23-17(28)29-14)24-5-7-25(8-6-24)15(26)3-4-22/h1-2,9-10H,3-8,22H2,(H,23,27,28)/b14-10+ |
| InChIKey | ICWUIWMORCNFBC-GXDHUFHOSA-N |
| XLogP | 2.03 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|