C23H27F3N4O5S — CID 76782378
tert-butyl N-[3-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxopropyl]carbamate (PubChem CID 76782378) has the molecular formula C23H27F3N4O5S and a molecular weight of 528.55 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 76782378 |
| Molecular Formula | C23H27F3N4O5S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCN(c2ccc(C(F)(F)F)cc2C=C2SC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C23H27F3N4O5S/c1-22(2,3)35-20(33)27-7-6-18(31)30-10-8-29(9-11-30)16-5-4-15(23(24,25)26)12-14(16)13-17-19(32)28-21(34)36-17/h4-5,12-13H,6-11H2,1-3H3,(H,27,33)(H,28,32,34) |
| InChIKey | KUONKQZCUHUYBP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|