C25H34N4O5S — CID 58423119
tert-butyl N-[5-[4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-1,4-diazepan-1-yl]-5-oxopentyl]carbamate (PubChem CID 58423119) has the molecular formula C25H34N4O5S and a molecular weight of 502.64 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-1,4-diazepan-1-yl]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-1,4-diazepan-1-yl]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 58423119 |
| Molecular Formula | C25H34N4O5S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | tert-butyl N-[5-[4-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-1,4-diazepan-1-yl]-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(=O)N1CCCN(c2ccccc2/C=C2\SC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C25H34N4O5S/c1-25(2,3)34-23(32)26-12-7-6-11-21(30)29-14-8-13-28(15-16-29)19-10-5-4-9-18(19)17-20-22(31)27-24(33)35-20/h4-5,9-10,17H,6-8,11-16H2,1-3H3,(H,26,32)(H,27,31,33)/b20-17- |
| InChIKey | VTKUFDSMTBRYJB-JZJYNLBNSA-N |
| XLogP | 3.74 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|