C18H22N4O4S — CID 87386192
tert-butyl 4-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 87386192) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is tert-butyl 4-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87386192 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | tert-butyl 4-[3-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncccc2/C=C2/SC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C18H22N4O4S/c1-18(2,3)26-17(25)22-9-7-21(8-10-22)14-12(5-4-6-19-14)11-13-15(23)20-16(24)27-13/h4-6,11H,7-10H2,1-3H3,(H,20,23,24)/b13-11+ |
| InChIKey | ONTUHNOGHFRKJI-ACCUITESSA-N |
| XLogP | 2.46 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|