C17H25N5O4 — CID 139512603
tert-butyl 4-[3-(acetamidocarbamoyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 139512603) has the molecular formula C17H25N5O4 and a molecular weight of 363.42 g/mol. Its IUPAC name is tert-butyl 4-[3-(acetamidocarbamoyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(acetamidocarbamoyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139512603 |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | tert-butyl 4-[3-(acetamidocarbamoyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(=O)NNC(=O)c1cccnc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H25N5O4/c1-12(23)19-20-15(24)13-6-5-7-18-14(13)21-8-10-22(11-9-21)16(25)26-17(2,3)4/h5-7H,8-11H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | ZPLQIIPFEARRMF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|