C20H32N4O2 — CID 102541722
tert-butyl 4-[3-(1-ethylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 102541722) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl 4-[3-(1-ethylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(1-ethylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 102541722 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | tert-butyl 4-[3-(1-ethylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CCN1CCCC1c1cccnc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H32N4O2/c1-5-22-11-7-9-17(22)16-8-6-10-21-18(16)23-12-14-24(15-13-23)19(25)26-20(2,3)4/h6,8,10,17H,5,7,9,11-15H2,1-4H3 |
| InChIKey | CDYDZDWAKPFBSN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |