C21H34N4O2 — CID 102541695
tert-butyl 4-[5-(1-propylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 102541695) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl 4-[5-(1-propylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(1-propylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 102541695 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | tert-butyl 4-[5-(1-propylpyrrolidin-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CCCN1CCCC1c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C21H34N4O2/c1-5-10-23-11-6-7-18(23)17-8-9-19(22-16-17)24-12-14-25(15-13-24)20(26)27-21(2,3)4/h8-9,16,18H,5-7,10-15H2,1-4H3 |
| InChIKey | FSTUIIBEZZWSAD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |